## Contents 1. [About](#about) 2. [Definitions](#definitions) 3. [The Least You Can Do](#the-least-you-can-do) 4. [Structured And Fast](#structured-and-fast) 5. [How Every Game Works](#how-every-game-works) 6. [Gamebooks](#gamebooks) 7. [Answering Prompts And Journaling](#answering-prompts-and-journaling) 8. [Your Approximate Self](#your-approximate-self) 9. [Continuity Of You](#continuity-of-you)…
Hello and welcome to Blog Buddies! To the best of my knowledge this format was recently pioneered by Mint / @theresattrpgforthat and Josh / @goblincow. https://www.tumblr.com/theresattrpgforthat/789959230903943168/blog-buddies-goblincow ...and when sean shared it over on his discord we both thought it was so utterly cute that we decided to apply that most cherished and time-honoured of ttrpg…
## CONTENTS 1. [INTRO](#intro) 2. [GENESIS](#genesis) 3. [WORLD HISTORY](#world-history) 4. [WORLD GEOGRAPHY](#world-geography) 5. [LOCAL GEOGRAPHY](#local-geography) 6. [DUNGEON BREACHES](#dungeon-breaches) 7. [DEATH](#death) 8. [SKY FAUNA](#sky-fauna) 9. [SELECT DENIZENS](#select-denizens) 10. [FRONTS](#fronts) ## INTRO I first ran Blue Harbor, "an idyllic seaside town where not everything is as…
HELLO THERE how would you like a gaming year in review? Yes? Good, okay. ## Contents 1. [Playing Games](#playing-games) * [Family Honey Heist](#family-honey-heist) * [Oneshots for my Friday Night group](#oneshots-for-my-friday-night-group) * [End of Magic Girls](#end-of-magic-girls) * [New Campaign For My Tuesday Night Group](#new-campaign-for-my-tuesday-night-group) * [Obojima Being…
I got an email the other day from Francesco Catenacci, a kind internet stranger, who offered to make an Italian translation of Shoes in the Dark. I immediately said yes, and now there are Italian shoes! In the Italian dark! It's been a couple years since I've looked at this game. I cleaned up the layout a wee bit in Scribus, and changed it to pull content from a markdown file instead of just…
## Contents 1. [About](#about) 2. [Getting Started](#getting-started) 3. [The Secret Undercrypt of the Demon Duke](#the-secret-undercrypt-of-the-demon-duke) 4. [Entrance](#entrance) 5. [Traps](#traps) 6. [Shrieker](#shrieker) 7. [Conclusion](#conclusion) ## About This is a playthrough of DERPS with DERPS Dungeon Fantasy options. ## Getting Started Procedure 1. Make a couple of derps. 2. Download a…
## CONTENTS 1. [ABOUT](#about) 2. [CHARACTER CREATION](#character-creation) 3. [ANCESTRY](#ancestry) 4. [PROFESSIONS](#professions) 5. [GEAR](#gear) * [WEAPONS](#weapons) * [ARMOR](#armor) * [EQUIPMENT](#equipment) 6. [THE MAGIC SYSTEM](#the-magic-system) * [SPELL LEVELS](#spell-levels) * [ARMOR](#armor) * [RECHARGING](#recharging) * [ENCHANTMENT](#enchantment) 7. [VICTORY AND…
## CONTENTS 1. [ABOUT](#about) 2. [WELCOME](#welcome) 3. [CHARACTER CREATION](#character-creation) * [STRENGTH](#strength) 4. [THE COMBAT SYSTEM](#the-combat-system) * [TIME AND DISTANCE SCALE](#time-and-distance-scale) * [MOVEMENT](#movement) * [ORDER OF MOVEMENT AND ATTACK](#order-of-movement-and-attack) * [MOVEMENT RESTRICTIONS](#movement-restrictions) * [COMBAT](#combat) * [OTHER…
I forget exactly how I came across this, but there is a tiny little game from 1987 written by Jeff and 'Manda Dee and published by Reindeer Games. (It was their only game.) It was called TWERPS: The World's Easiest Role-Playing System. GURPS had come out the previous year, and the name is an obvious reference. Even though it was already ten years old at the time, D&D was still in its infancy. The…
Hubris, paranoia, and genius always served Beauregard Freeholder well. He was obsessive, secretive, and severely talented. He pursued magic with a singular, determined focus. For him it was a zero sum game: the more others had, the less he had. And the more he had, the less anyone else could challenge him. He surreptitiously stalked other wizards. He thieved wands, tomes, scrolls, and spells. Of…
## Contents 1. [Introduction](#introduction) 2. [Research](#research) 3. [Mystery](#mystery) 4. [Prep](#prep) 5. [Pushing Back](#pushing-back) 6. [Legal Procedure](#legal-procedure) ## Introduction After slowly building up to it over several sessions of plot advancement, I finally ran my "Ace Attorney" D&D courtroom legal drama this week. It was super fun! The setup was this: my players' favorite…
[Previously](77) my players did a hexcrawl from Blue Harbor to Beartown [to investigate their own death](78). The hexcrawling was fine. What I did enjoy was the random encounter tables I came up. What I did not enjoy was calculating travel speeds and being like, okay you traveled 6 miles out of this hex and 2 miles into this one. That felt like too much finicky bookkeeping. So on the way back, we…
You are an expert barber who just opened up a shop in Monstertown. You know that a haircut is never just a haircut. It's an opportunity to be daring, to re-invent yourself, to try something new, to see yourself in a new light. Each client has a special occasion they want to celebrate, for which they need a snappy new do. But each also has a challenging situation that will test your barber skills.…
Blue Harbor is the primary location, the base of operations, in [my Banankoki game](79.html). It is a coastal trading city with a bay and a harbor and a river running through the middle. There are mountains to the east, a desert beyond them, and farms to the north. It's just San Diego. When it came time to give my players a map of the area, I just traced an old visitors map. Please don't tell my…
## Contents 1. [Diplomacy](#diplomacy) 2. [Hyperdrift Stories](#hyperdrift-stories) 3. [From Wargames to Matrix Games](#from-wargames-to-matrix-games) 4. [From Wargames to Free Kriegspiel](#from-wargames-to-free-kriegspiel) 5. [Conclusion](#conclusion) 6. [Appendix: Floor Games](#appendix:-floor-games) 7. [Links and Resources](#links-and-resources) ## Diplomacy My boy Villainous Nate was just…
I recently started running a new campaign for my friends. I have used vimwiki to organize my previous two games, and the wiki format has worked really well for me, so I'm using it again this time. It's really convenient to be able to link easily between documents, and to search quickly. The challenge with wiki organization in the past has been orphan pages. I might make a quick page to jot down…
1. Never Have I Ever: one person says something they have not done, and everybody says whether they've done it or not, then everybody drinks. 2. Liars Dice: everybody rolls five dice, then go around the table making increasingly outlandish claims about the number and value of dice rolled until somebody calls somebody else's bluff. Everybody drinks. 3. Rock Paper Scissors: On 3, everybody shows a…
When I sat down to create the world map for my new D&D campaign, I drew on all of the skills and experiences I gained in Kindergarten fingerpainting class, and sketched two rudimentary shapes on a piece of paper. First, a long banana shape, which became the eastern continent Banan. Second, a blob of a cookie shape, which became the western island-continent Koki. Then, for variety, I split Banan…
I ended the session on a cliffhanger: > "You receive a letter. It is a summons to a remote mountain town to identify the body of (Insert PC Name Here)." The players were gobsmacked and thunderstruck. What followed was half a dozen sessions of trekking to the town, investigating the body, exploring the surrounding area, talking to villagers, and delving to the bottom of the dungeon. They uncovered…
## Contents 1. [Introduction](#introduction) 2. [Speed, Distance, and Time](#speed,-distance,-and-time) 3. [Supplies](#supplies) 4. [Weather](#weather) 5. [Keying Hexes](#keying-hexes) 6. [Watch Procedure](#watch-procedure) 7. [Terrain Type](#terrain-type) 8. [Overtable](#overtable) 9. [Proximity](#proximity) 10. [NPC Reaction](#npc-reaction) 11. [What Are They Doing](#what-are-they-doing) 12.…
It ain't D&D! Here are some of the innovations / changes that D-Heart brings to the table - An asymmetrical, 2-dimensional Action Roll. Players roll 2d12 versus a target number, which gives them reliable success, while the GM rolls 1d20 for swingy, spikey, unpredictable rolls. Also the player's of two d12, one is a Hope die and the other a Fear die. So you suddenly have orthogonal outcomes:…
I hooked up with a new group of players trying to start a new game. There was an initial struggle to figure out where to play. I would normally offer to host but we just downsized and moved into a small apartment and got rid of our big table. The DM was in a similar situation: in a small space with no table. So the question was posed: what is a public space where can we play on a Sunday evening? I…
## Contents 1. [Introduction](#introduction) 2. [Character Creation](#character-creation) 3. [Playing the game](#playing-the-game) 4. [Running the game](#running-the-game) 5. [Paranormal Investigation](#paranormal-investigation) ## Introduction Ghostbusters is a pretty great game! There are two books: the Training Manual which is—to use the rosetta stone of tabletop games—essentially…
## Contents 1. [Intro](#intro) 2. [Session 0](#session-0) * [Agenda](#agenda) * [Why play D&D](#why-play-d&d) * [Logistics](#logistics) * [Safety](#safety) * [World Building](#world-building) * [Character Creation](#character-creation) 3. [Session 0.5](#session-0.5) * [Setup](#setup) * [Situation](#situation) * [Solution](#solution) ## Intro Started a new D&D campaign last week. It was super fun!…
## Contents 1. [Previously on Dozens and Dragons](#previously-on-dozens-and-dragons) 2. [Less Prep More Collaboration](#less-prep-more-collaboration) 3. [Turning Failure Into Success](#turning-failure-into-success) 4. [Games Are Not Simulations](#games-are-not-simulations) 5. [Conclusion](#conclusion) 6. [Further Reading](#further-reading) ## Previously on Dozens and Dragons The implied values of…
## Contents 1. [Dungeons & Dragons](#dungeons-&-dragons) 2. [Gumshoe](#gumshoe) 3. [Cthulhu Dark](#cthulhu-dark) 4. [Carved From Brindlewood](#carved-from-brindlewood) 5. [We Used To Be Friends](#we-used-to-be-friends) ## Dungeons & Dragons D&D, Pathfinder, etc. First plan a whole mystery with suspects and clues and a correct answer and everything. Roll Intelligence (Investigation). If you pass,…
NO ONE EVER LEAVES by dozens ## CONTENTS {.nav} - [LIST OF TABLES](#list-of-tables) - [LEGAL](#legal) - [THIS OLD SPOOKY HOUSE WILL BE A MUCH NEEDED FRESH START FOR OUR FAMILY I CAN'T BELIEVE IT WAS LISTED FOR SO CHEAP SURELY IT WILL BRING US CLOSER TOGETHER AND WE WILL REGRET ABSOLUTELY NOTHING ABOUT THIS LIFE-ALTERING DECISION…
A Very Special Lyrmwithmas by dozens ## CONTENTS - [ABOUT](#about) - [HOW TO PLAY](#how-to-play) - [ANSWER BUBBLES](#answer-bubbles) - [DESERT BLOOM](#desert-bloom) - [PLAYBOOK](#playbook) - [BOONS](#boons) - [GLOOMS](#glooms) - [BEATS](#beats) - [APPENDIX: SPARKS](#appendix-sparks) - [APPENDIX: 1dEVERYTHING](#appendix-1deverything) - [APPENDIX: RECIPES](#appendix-recipes) - [APPENDIX: THE BALLAD…
## CONTENTS 1. [BACKGROUND](#background) 2. [MULTIBACKGROUND](#multibackground) 3. [METHODS](#methods) * [1. SMOOSH THEM TOGETHER](#1.-smoosh-them-together) * [2. PICKLIST](#2.-picklist) * [3. MINI BACKGROUNDS](#3.-mini-backgrounds) 4. [APPLICATION](#application) ## BACKGROUND Imagine an investigate mystery game like Call of Cthulhu by way of Troika called *Cryptid Capers!* There should be at…
## CONTENTS 1. [INTRODUCTION](#introduction) 2. [WHAT IS A ROLEPLAYING GAME?](#what-is-a-roleplaying-game?) 3. [MAKE A LIL GUY](#make-a-lil-guy) * [YOU HAVE THREE STATS](#you-have-three-stats) * [STAT MODIFIERS](#stat-modifiers) * [FILL IN THE REST](#fill-in-the-rest) * [EXAMPLE CARABAO](#example-carabao) 4. [DOING STUFF](#doing-stuff) 5. [GETTING STARTED](#getting-started) 6.…
::: warning > **WARNING**: > if you are one of my lancer townies, > know there are minor spoilers herein > for our current campaign ::: ## Contents 1. [Lancer is two games smooshed into one](#lancer-is-two-games-smooshed-into-one) 2. [Starting with a oneshot](#starting-with-a-oneshot) 3. [Battlemap](#battlemap) 4. [Links](#links) ## Lancer is two games smooshed into one So I'm kicking off a…
## Introduction Some friends and I are discussing starting a game of Lancer. And somebody who is interested in playing remarked that they want to know who the GM is going to be and what kind of campaign we'll be running before they commit to signing up and making a character. I think this is a reasonable request! In the tech world and especially in tech management there is a current trend of…
## Contents 1. [Growing My Collection](#growing-my-collection) 2. [Defining Metadata with EXIF](#defining-metadata-with-exif) 3. [Cataloging](#cataloging) 4. [Links](#links) ## Growing My Collection I have been collecting ttrpgs for a lot of years now. At first they were all just in my Downloads folder all willy-nilly with no thought or effort given toward organizing them at all. Eventually I…
> Preface: > This is an exercise I did > back in summer of 2022 > for my > "Cleric + Thief" > solo game. > It is an execution of > KJ Davies's > Polyhedral Pantheon Design, > and was really quite fun! > What follows now > is the original post > I made in my gaming journal, > with additional edits for clarity. We're gonna make a whole bunch of gods. Like, way too many gods. Here are the core…
This is a game that I play every time I go to the library. Now you can play it too! What : When you find yourself at the public library, choose a random three-digit dewey decimal number. Read it forwards and backwards so now you have two numbers. For each, go to that section of the stacks and find the book at, or nearest to, that number. Pick it up and look at it. Read the back. Read the table of…
## Mechanic I don't know what to do with this thing, but I am quite enamored with it. ``` . 1 2 3 4 5 6 1 a b c d e f 2 g u u w w h 3 i u y y w j 4 k x z z v l 5 m x x v v n 6 o p q r s t ``` Figure: A two dimensional d66 grid It is a two dimensional d66 grid. You roll two six-sided dice (or one die twice), one for the x-axis and one for the y-axis. And then look up the corresponding letter on the…
## For Sale By Owner > Rovoron Kullter Luxury Electric Scooter (Only rode 5 times) - $1,100 (Denver) > > Too fast and too powerful. Fell down twice I can't ride this > >…
## Contents 1. [About](#about) 2. [Your Evil Plan](#your-evil-plan) 3. [How To Play](#how-to-play) 4. [Codex](#codex) 5. [Dice Pool](#dice-pool) 6. [Progress Tracks](#progress-tracks) 7. [Credits](#credits) ## About You are octogenarian mad scientist Montana Jack. You have an evil plan to get rich by creating giant mutant hybrid bighorn sheep. It is an affront to nature and an insult to god, and…
## CONTENTS 1. [INTRODUCTION](#introduction) 2. [ARSINO D6](#arsino-d6) 3. [MULTIPLY WITH CARRY](#multiply-with-carry) 4. [POCKET DICE ROLLER](#pocket-dice-roller) ## INTRODUCTION What is up, here are three random number generators so you can roll dice without any dice for when you are gaming on the go! The first two you can do entirely in your head. The third will require printing or copying a…
## CONTENTS 1. [BLOGS I BLOGGED](#blogs-i-blogged) 2. [GAMES I PLAYED](#games-i-played) 3. [GAMES I PUBLISHED](#games-i-published) ## BLOGS I BLOGGED I did 17 bloggers in 2k23, the year of the Barbie Movie. I keep the source of all of my blog posts in these m4 files. And luckily they all include metadata including title and date. So I do some funky sed regex search and replace to format them in…
This is for my boy acdw who asked for suggestions for games he can play with his wife. ## Contents 1. [Games](#games) 2. [Oracles](#oracles) 3. [Scenarios](#scenarios) ## Games I don't know if a table is the best way to show this data, but that's what I'm going to use. name vibe facilitation materials pros cons cost url url_2 -------------------------------------…
okay so once upon a time there was this star wars roleplaying game by fantasy flight games. it used these colorful six, eight, and twelve sided dice that instead of having numbers had these weird abstract symbols. they are oddly compelling with their mysterious glyphs and their red, yellow, green, purple, black, and blue. then ffg decided to abstract this system into a generic roleplaying system…
## CONTENTS 1. [PREFACE](#preface) 3. [ABOUT](#about) 4. [YOU WILL NEED](#you-will-need) 5. [GETTING STARTED](#getting-started) 6. [FISHBLADE](#fishblade) 7. [FISHFINGERS](#fishfingers) * [ALTERNATIVE RULES: COINS OF FATE](#alternative-rules:-coins-of-fate) 8. [FISHFIGHT!](#fishfight!) 9. [PLAY](#play) 10. [SCORING](#scoring) 11. [CREDITS](#credits) ## PREFACE Hi! I just found this in a draft…
Dead Dog Beach is the unofficial but universally acknowledged name for the isolated stretch of rocky cliffside beach at the south end of Blue Harbor, just past Point Kel. Practically inaccessible from the popular sandy beaches north of the point, Dead Dog Beach can only really be reached from Lee Luthier's Pet Mortuary atop Point Kel. Nearly everybody in Blue Harbor visits Lee's at some point. At…
## CONTENTS 1. [ABOUT](#about) 2. [CREATING A CHARACTER](#creating-a-character) 3. [DOING STUFF](#doing-stuff) 4. [RESTING AND RECOVERY](#resting-and-recovery) 5. [ADVANCEMENT AND GETTING BETTER](#advancement-and-getting-better) 6. [DEATH AND RETIREMENT](#death-and-retirement) 7. [VIOLENCE](#violence) 8. [ENCOUNTERS](#encounters) 9. [ADVENTURES](#adventures) 10. [RESOURCES AND…
## CONTENTS 1. [ABOUT](#about) 2. [YOU WILL NEED](#you-will-need) 3. [INTRO](#intro) 4. [MAKE A VAMPIRE](#make-a-vampire) * [VAMPIRE NAME AND TITLE](#vampire-name-and-title) * [VAMPIRE STATS](#vampire-stats) * [BLOOD LUCK FAVOR](#blood-luck-favor) 5. [MAKE SOME BASEBALL TEAMS](#make-some-baseball-teams) * [HOMETOWNS](#hometowns) * [TEAM NAMES](#team-names) 6. [GAMELOOP](#gameloop) * [PLAY…
## CONTENTS 1. [GIRAFFE NAMES](#giraffe-names) 2. [GIRAFFE PLACES](#giraffe-places) * [1. Giraffe Home](#1.-giraffe-home) * [2. Great Tree](#2.-great-tree) * [3. Watering Hole](#3.-watering-hole) * [4. Elephants](#4.-elephants) * [5. Lions Den](#5.-lions-den) * [6. Hyenas](#6.-hyenas) 3. [GIRAFFE ENCOUNTERS](#giraffe-encounters) ## GIRAFFE NAMES Give your giraffe a name! A giraffe can have any…
## Contents 1. [About](#about) 2. [Create a Giraffe](#create-a-giraffe) 3. [Doing Stuff (Basic)](#doing-stuff-(basic)) 4. [Doing Stuff (With Dice!)](#doing-stuff-(with-dice!)) 5. [Results](#results) 6. [Special Rolls](#special-rolls) 7. [End](#end) ## About This is a roleplaying game. Here's what you need to know. 1. You are a giraffe 2. You want to get the best leaves 3. They are so high up the…
## Contents 1. [Intro](#intro) 2. [Sunday Morning](#sunday-morning) 3. [Moonlight on Roseville Beach](#moonlight-on-roseville-beach) 4. [Cypher System](#cypher-system) 5. [House Of Cards](#house-of-cards) 6. [The Lady I Am Rescuing From Zombie Island Is Difficult To Read](#the-lady-i-am-rescuing-from-zombie-island-is-difficult-to-read) 7. [Relic](#relic) 8. [Bleak Spirit](#bleak-spirit) ## Intro…
> They can but bring horse to the water brink > But horse may choose whether that horse will drink[^brink] [^brink]: *Narcissus*, 1602. ## CONTENTS 1. [ABOUT](#about) 5. [HORSE MAGIC](#horse-magic) 6. [HORSE PLOT](#horse-plot) 7. [HORSE LOCATIONS](#horse-locations) ## ABOUT *Horses on the brink!* is a supplement for SPORTS HORSE[^sportshorse] providing a loose setting (see: [HORSE…